C23H37N5O2 — CID 118708792
N-(6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-yl)-N',N'-diethylpentane-1,5-diamine (PubChem CID 118708792) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-(6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-yl)-N',N'-diethylpentane-1,5-diamine.
| Compound Name | N-(6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-yl)-N',N'-diethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 118708792 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-(6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-yl)-N',N'-diethylpentane-1,5-diamine |
| SMILES | CCN(CC)CCCCCNc1nc(N2CCCC2)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C23H37N5O2/c1-5-27(6-2)13-9-7-8-12-24-22-18-16-20(29-3)21(30-4)17-19(18)25-23(26-22)28-14-10-11-15-28/h16-17H,5-15H2,1-4H3,(H,24,25,26) |
| InChIKey | MNLMYEFNITULBF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|