C21H38N6 — CID 67535108
N-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N',N'-diethylpentane-1,5-diamine (PubChem CID 67535108) has the molecular formula C21H38N6 and a molecular weight of 374.58 g/mol. Its IUPAC name is N-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N',N'-diethylpentane-1,5-diamine.
| Compound Name | N-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N',N'-diethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 67535108 |
| Molecular Formula | C21H38N6 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | N-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N',N'-diethylpentane-1,5-diamine |
| SMILES | CCN(CC)CCCCCNc1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C21H38N6/c1-3-25(4-2)13-7-5-6-12-22-19-18-20(26-14-8-9-15-26)24-21(23-19)27-16-10-11-17-27/h18H,3-17H2,1-2H3,(H,22,23,24) |
| InChIKey | GAFDGPLSMNTEAK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|