C19H34N6 — CID 142760300
N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N,N'-dimethylpentane-1,5-diamine (PubChem CID 142760300) has the molecular formula C19H34N6 and a molecular weight of 346.52 g/mol. Its IUPAC name is N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N,N'-dimethylpentane-1,5-diamine.
| Compound Name | N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N,N'-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 142760300 |
| Molecular Formula | C19H34N6 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N,N'-dimethylpentane-1,5-diamine |
| SMILES | CNCCCCCN(C)c1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H34N6/c1-20-10-4-3-5-11-23(2)17-16-18(24-12-6-7-13-24)22-19(21-17)25-14-8-9-15-25/h16,20H,3-15H2,1-2H3 |
| InChIKey | XVXNAVSOIMCLJV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|