C17H30N6 — CID 67534033
N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)pentane-1,5-diamine (PubChem CID 67534033) has the molecular formula C17H30N6 and a molecular weight of 318.47 g/mol. Its IUPAC name is N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)pentane-1,5-diamine.
| Compound Name | N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 67534033 |
| Molecular Formula | C17H30N6 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | N'-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)pentane-1,5-diamine |
| SMILES | NCCCCCNc1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C17H30N6/c18-8-2-1-3-9-19-15-14-16(22-10-4-5-11-22)21-17(20-15)23-12-6-7-13-23/h14H,1-13,18H2,(H,19,20,21) |
| InChIKey | GSUIWUNGJBUZTD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|