C28H38N8S — CID 25115501
1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-naphthalen-1-ylthiourea (PubChem CID 25115501) has the molecular formula C28H38N8S and a molecular weight of 518.74 g/mol. Its IUPAC name is 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-naphthalen-1-ylthiourea.
| Compound Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 25115501 |
| Molecular Formula | C28H38N8S |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-naphthalen-1-ylthiourea |
| SMILES | CN(CCNc1cc(N2CCCC2)nc(N2CCCC2)n1)CCN(C(N)=S)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H38N8S/c1-33(19-20-36(27(29)37)24-12-8-10-22-9-2-3-11-23(22)24)18-13-30-25-21-26(34-14-4-5-15-34)32-28(31-25)35-16-6-7-17-35/h2-3,8-12,21H,4-7,13-20H2,1H3,(H2,29,37)(H,30,31,32) |
| InChIKey | MXTYFWBMNBEMDR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|