C24H37N9O2S2 — CID 25116663
1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 25116663) has the molecular formula C24H37N9O2S2 and a molecular weight of 547.76 g/mol. Its IUPAC name is 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 25116663 |
| Molecular Formula | C24H37N9O2S2 |
| Molecular Weight | 547.76 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CN(CCNC(=S)Nc1ccc(S(N)(=O)=O)cc1)CCNc1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C24H37N9O2S2/c1-31(17-11-27-24(36)28-19-6-8-20(9-7-19)37(25,34)35)16-10-26-21-18-22(32-12-2-3-13-32)30-23(29-21)33-14-4-5-15-33/h6-9,18H,2-5,10-17H2,1H3,(H2,25,34,35)(H,26,29,30)(H2,27,28,36) |
| InChIKey | ZUFHSOSNWPLRFC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|