C27H38N10S — CID 87436009
1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-(4-pyrazol-1-ylphenyl)thiourea (PubChem CID 87436009) has the molecular formula C27H38N10S and a molecular weight of 534.74 g/mol. Its IUPAC name is 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-(4-pyrazol-1-ylphenyl)thiourea.
| Compound Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-(4-pyrazol-1-ylphenyl)thiourea |
|---|---|
| PubChem CID | 87436009 |
| Molecular Formula | C27H38N10S |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-(4-pyrazol-1-ylphenyl)thiourea |
| SMILES | CN(CCNc1cc(N2CCCC2)nc(N2CCCC2)n1)CCN(C(N)=S)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C27H38N10S/c1-33(19-20-36(26(28)38)22-7-9-23(10-8-22)37-17-6-11-30-37)18-12-29-24-21-25(34-13-2-3-14-34)32-27(31-24)35-15-4-5-16-35/h6-11,17,21H,2-5,12-16,18-20H2,1H3,(H2,28,38)(H,29,31,32) |
| InChIKey | KKRKLPANQMRHRW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|