C18H25ClN8S — CID 87433178
1-(4-chlorophenyl)-1-[2-[2-[[6-(diazetidin-1-yl)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]thiourea (PubChem CID 87433178) has the molecular formula C18H25ClN8S and a molecular weight of 420.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-[2-[2-[[6-(diazetidin-1-yl)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-1-[2-[2-[[6-(diazetidin-1-yl)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 87433178 |
| Molecular Formula | C18H25ClN8S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-(4-chlorophenyl)-1-[2-[2-[[6-(diazetidin-1-yl)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]thiourea |
| SMILES | CN(CCNc1cc(N2CCN2)ncn1)CCN(C(N)=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN8S/c1-25(10-11-26(18(20)28)15-4-2-14(19)3-5-15)8-6-21-16-12-17(23-13-22-16)27-9-7-24-27/h2-5,12-13,24H,6-11H2,1H3,(H2,20,28)(H,21,22,23) |
| InChIKey | STPOKBPGPGRQNE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|