C18H21ClN4O2 — CID 95564096
(4-chlorophenyl)-[(3S)-1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]piperidin-3-yl]methanone (PubChem CID 95564096) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3S)-1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3S)-1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 95564096 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (4-chlorophenyl)-[(3S)-1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H]1CCCN(c2cc(NCCO)ncn2)C1 |
| InChI | InChI=1S/C18H21ClN4O2/c19-15-5-3-13(4-6-15)18(25)14-2-1-8-23(11-14)17-10-16(20-7-9-24)21-12-22-17/h3-6,10,12,14,24H,1-2,7-9,11H2,(H,20,21,22)/t14-/m0/s1 |
| InChIKey | ZTLLXQRBRAAFCM-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |