C24H35ClN8S — CID 25114808
1-(4-chlorophenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea (PubChem CID 25114808) has the molecular formula C24H35ClN8S and a molecular weight of 503.12 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 25114808 |
| Molecular Formula | C24H35ClN8S |
| Molecular Weight | 503.12 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea |
| SMILES | CN(CCNC(=S)Nc1ccc(Cl)cc1)CCNc1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C24H35ClN8S/c1-31(17-11-27-24(34)28-20-8-6-19(25)7-9-20)16-10-26-21-18-22(32-12-2-3-13-32)30-23(29-21)33-14-4-5-15-33/h6-9,18H,2-5,10-17H2,1H3,(H,26,29,30)(H2,27,28,34) |
| InChIKey | XRQNMZPMVPNCHI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|