C24H39ClN8S — CID 87433451
1-[2-[2-[[2,6-bis(diethylamino)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]-3-(4-chlorophenyl)thiourea (PubChem CID 87433451) has the molecular formula C24H39ClN8S and a molecular weight of 507.15 g/mol. Its IUPAC name is 1-[2-[2-[[2,6-bis(diethylamino)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[2-[2-[[2,6-bis(diethylamino)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 87433451 |
| Molecular Formula | C24H39ClN8S |
| Molecular Weight | 507.15 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 1-[2-[2-[[2,6-bis(diethylamino)pyrimidin-4-yl]amino]ethyl-methylamino]ethyl]-3-(4-chlorophenyl)thiourea |
| SMILES | CCN(CC)c1cc(NCCN(C)CCNC(=S)Nc2ccc(Cl)cc2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C24H39ClN8S/c1-6-32(7-2)22-18-21(29-23(30-22)33(8-3)9-4)26-14-16-31(5)17-15-27-24(34)28-20-12-10-19(25)11-13-20/h10-13,18H,6-9,14-17H2,1-5H3,(H,26,29,30)(H2,27,28,34) |
| InChIKey | RTMURNXFVPFTMA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|