C28H44N8S — CID 25115729
1-(4-tert-butylphenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea (PubChem CID 25115729) has the molecular formula C28H44N8S and a molecular weight of 524.78 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 25115729 |
| Molecular Formula | C28H44N8S |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]thiourea |
| SMILES | CN(CCNC(=S)Nc1ccc(C(C)(C)C)cc1)CCNc1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C28H44N8S/c1-28(2,3)22-9-11-23(12-10-22)31-27(37)30-14-20-34(4)19-13-29-24-21-25(35-15-5-6-16-35)33-26(32-24)36-17-7-8-18-36/h9-12,21H,5-8,13-20H2,1-4H3,(H,29,32,33)(H2,30,31,37) |
| InChIKey | LLELMIQVZVDONJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|