C17H23N5O2S — CID 134712640
4-[[(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]benzenesulfonamide (PubChem CID 134712640) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[[(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134712640 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-[[(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]benzenesulfonamide |
| SMILES | CCc1cc(NCc2ccc(S(N)(=O)=O)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C17H23N5O2S/c1-2-14-11-16(21-17(20-14)22-9-3-4-10-22)19-12-13-5-7-15(8-6-13)25(18,23)24/h5-8,11H,2-4,9-10,12H2,1H3,(H2,18,23,24)(H,19,20,21) |
| InChIKey | CUCYHXAJQMWOQZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |