C16H28N6 — CID 19428533
N-tert-butyl-6-piperazin-1-yl-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 19428533) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is N-tert-butyl-6-piperazin-1-yl-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-tert-butyl-6-piperazin-1-yl-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 19428533 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | N-tert-butyl-6-piperazin-1-yl-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | CC(C)(C)Nc1cc(N2CCNCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C16H28N6/c1-16(2,3)20-13-12-14(21-10-6-17-7-11-21)19-15(18-13)22-8-4-5-9-22/h12,17H,4-11H2,1-3H3,(H,18,19,20) |
| InChIKey | OOSKUUINKYZPRJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |