C20H27N5 — CID 173080172
N-ethyl-N-phenyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 173080172) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-ethyl-N-phenyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-ethyl-N-phenyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 173080172 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-ethyl-N-phenyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | CCN(c1ccccc1)c1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C20H27N5/c1-2-25(17-10-4-3-5-11-17)19-16-18(23-12-6-7-13-23)21-20(22-19)24-14-8-9-15-24/h3-5,10-11,16H,2,6-9,12-15H2,1H3 |
| InChIKey | HNLRMLWOUQNOCW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |