C14H24N4 — CID 62745440
3-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-methylpropan-1-amine (PubChem CID 62745440) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62745440 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 3-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1c(C)nc(N2CCCC2)nc1C |
| InChI | InChI=1S/C14H24N4/c1-11-13(7-6-8-15-3)12(2)17-14(16-11)18-9-4-5-10-18/h15H,4-10H2,1-3H3 |
| InChIKey | OOWIQYOTBYJMBZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|