C17H28N4 — CID 62744044
N-[3-(4,6-dimethyl-2-piperidin-1-ylpyrimidin-5-yl)propyl]cyclopropanamine (PubChem CID 62744044) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[3-(4,6-dimethyl-2-piperidin-1-ylpyrimidin-5-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(4,6-dimethyl-2-piperidin-1-ylpyrimidin-5-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62744044 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | N-[3-(4,6-dimethyl-2-piperidin-1-ylpyrimidin-5-yl)propyl]cyclopropanamine |
| SMILES | Cc1nc(N2CCCCC2)nc(C)c1CCCNC1CC1 |
| InChI | InChI=1S/C17H28N4/c1-13-16(7-6-10-18-15-8-9-15)14(2)20-17(19-13)21-11-4-3-5-12-21/h15,18H,3-12H2,1-2H3 |
| InChIKey | QJOMGWZWTFVNLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|