C18H31N5O2 — CID 54086029
N-[2-(2-methoxyethoxy)ethyl]-N-methyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 54086029) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-N-methyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-N-methyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 54086029 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-N-methyl-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | COCCOCCN(C)c1cc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C18H31N5O2/c1-21(11-12-25-14-13-24-2)16-15-17(22-7-3-4-8-22)20-18(19-16)23-9-5-6-10-23/h15H,3-14H2,1-2H3 |
| InChIKey | MQNDRRWXPSRDGK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|