C30H42BrN5O — CID 165134670
4-N-[(3-bromophenyl)methyl]-6-methoxy-7-N,2-dimethyl-7-N-(7-piperidin-1-ylheptyl)quinazoline-4,7-diamine (PubChem CID 165134670) has the molecular formula C30H42BrN5O and a molecular weight of 568.60 g/mol. Its IUPAC name is 4-N-[(3-bromophenyl)methyl]-6-methoxy-7-N,2-dimethyl-7-N-(7-piperidin-1-ylheptyl)quinazoline-4,7-diamine.
| Compound Name | 4-N-[(3-bromophenyl)methyl]-6-methoxy-7-N,2-dimethyl-7-N-(7-piperidin-1-ylheptyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 165134670 |
| Molecular Formula | C30H42BrN5O |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 4-N-[(3-bromophenyl)methyl]-6-methoxy-7-N,2-dimethyl-7-N-(7-piperidin-1-ylheptyl)quinazoline-4,7-diamine |
| SMILES | COc1cc2c(NCc3cccc(Br)c3)nc(C)nc2cc1N(C)CCCCCCCN1CCCCC1 |
| InChI | InChI=1S/C30H42BrN5O/c1-23-33-27-21-28(35(2)15-8-5-4-6-9-16-36-17-10-7-11-18-36)29(37-3)20-26(27)30(34-23)32-22-24-13-12-14-25(31)19-24/h12-14,19-21H,4-11,15-18,22H2,1-3H3,(H,32,33,34) |
| InChIKey | VCBHIWKXWDVWAV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|