C25H35N5O — CID 162761768
6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine (PubChem CID 162761768) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine.
| Compound Name | 6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 162761768 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)ncnc2cc1C#CCCN1CCCC1 |
| InChI | InChI=1S/C25H35N5O/c1-19(2)30-14-9-21(10-15-30)28-25-22-17-24(31-3)20(16-23(22)26-18-27-25)8-4-5-11-29-12-6-7-13-29/h16-19,21H,5-7,9-15H2,1-3H3,(H,26,27,28) |
| InChIKey | PUWYGYXAJJNVGA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|