C25H37N5O4 — CID 175431027
6-methoxy-2-morpholin-2-yl-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 175431027) has the molecular formula C25H37N5O4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 6-methoxy-2-morpholin-2-yl-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | 6-methoxy-2-morpholin-2-yl-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 175431027 |
| Molecular Formula | C25H37N5O4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 6-methoxy-2-morpholin-2-yl-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCOCC3)nc(C3CNCCO3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H37N5O4/c1-31-21-15-19-20(16-22(21)33-11-4-10-30-8-2-3-9-30)28-25(23-17-26-7-14-34-23)29-24(19)27-18-5-12-32-13-6-18/h15-16,18,23,26H,2-14,17H2,1H3,(H,27,28,29) |
| InChIKey | FBABYJUCBXAEMV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|