C25H35N3O5 — CID 135155651
formic acid;8-methoxy-N-[(3S)-oxolan-3-yl]-7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine (PubChem CID 135155651) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is formic acid;8-methoxy-N-[(3S)-oxolan-3-yl]-7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine.
| Compound Name | formic acid;8-methoxy-N-[(3S)-oxolan-3-yl]-7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine |
|---|---|
| PubChem CID | 135155651 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | formic acid;8-methoxy-N-[(3S)-oxolan-3-yl]-7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine |
| SMILES | COc1cc2c3c(c(N[C@H]4CCOC4)nc2cc1OCCCN1CCCC1)CCC3.O=CO |
| InChI | InChI=1S/C24H33N3O3.CH2O2/c1-28-22-14-20-18-6-4-7-19(18)24(25-17-8-13-29-16-17)26-21(20)15-23(22)30-12-5-11-27-9-2-3-10-27;2-1-3/h14-15,17H,2-13,16H2,1H3,(H,25,26);1H,(H,2,3)/t17-;/m0./s1 |
| InChIKey | RRNTWLLHZMRAJI-LMOVPXPDSA-N |
| XLogP | 3.50 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|