C22H31N3O3 — CID 135155664
8-methoxy-N-propan-2-yl-7-(3-pyrrolidin-1-ylpropoxy)-1,3-dihydrofuro[3,4-c]quinolin-4-amine (PubChem CID 135155664) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 8-methoxy-N-propan-2-yl-7-(3-pyrrolidin-1-ylpropoxy)-1,3-dihydrofuro[3,4-c]quinolin-4-amine.
| Compound Name | 8-methoxy-N-propan-2-yl-7-(3-pyrrolidin-1-ylpropoxy)-1,3-dihydrofuro[3,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 135155664 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 8-methoxy-N-propan-2-yl-7-(3-pyrrolidin-1-ylpropoxy)-1,3-dihydrofuro[3,4-c]quinolin-4-amine |
| SMILES | COc1cc2c3c(c(NC(C)C)nc2cc1OCCCN1CCCC1)COC3 |
| InChI | InChI=1S/C22H31N3O3/c1-15(2)23-22-18-14-27-13-17(18)16-11-20(26-3)21(12-19(16)24-22)28-10-6-9-25-7-4-5-8-25/h11-12,15H,4-10,13-14H2,1-3H3,(H,23,24) |
| InChIKey | ORIGEDGHZUMICB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|