C23H33N3O3 — CID 135185090
N-ethyl-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-3,4-dihydro-1H-pyrano[4,3-c]quinolin-5-amine (PubChem CID 135185090) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-ethyl-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-3,4-dihydro-1H-pyrano[4,3-c]quinolin-5-amine.
| Compound Name | N-ethyl-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-3,4-dihydro-1H-pyrano[4,3-c]quinolin-5-amine |
|---|---|
| PubChem CID | 135185090 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-ethyl-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-3,4-dihydro-1H-pyrano[4,3-c]quinolin-5-amine |
| SMILES | CCNc1nc2cc(OCCCN3CCCC3)c(OC)cc2c2c1CC(C)OC2 |
| InChI | InChI=1S/C23H33N3O3/c1-4-24-23-18-12-16(2)29-15-19(18)17-13-21(27-3)22(14-20(17)25-23)28-11-7-10-26-8-5-6-9-26/h13-14,16H,4-12,15H2,1-3H3,(H,24,25) |
| InChIKey | LLCHTKNDIPTXPY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|