C26H39N3O4 — CID 135155617
7-[3-(3,3-dimethylpyrrolidin-1-yl)propoxy]-8-methoxy-N-propan-2-yl-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine;formic acid (PubChem CID 135155617) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is 7-[3-(3,3-dimethylpyrrolidin-1-yl)propoxy]-8-methoxy-N-propan-2-yl-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine;formic acid.
| Compound Name | 7-[3-(3,3-dimethylpyrrolidin-1-yl)propoxy]-8-methoxy-N-propan-2-yl-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine;formic acid |
|---|---|
| PubChem CID | 135155617 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 7-[3-(3,3-dimethylpyrrolidin-1-yl)propoxy]-8-methoxy-N-propan-2-yl-2,3-dihydro-1H-cyclopenta[c]quinolin-4-amine;formic acid |
| SMILES | COc1cc2c3c(c(NC(C)C)nc2cc1OCCCN1CCC(C)(C)C1)CCC3.O=CO |
| InChI | InChI=1S/C25H37N3O2.CH2O2/c1-17(2)26-24-19-9-6-8-18(19)20-14-22(29-5)23(15-21(20)27-24)30-13-7-11-28-12-10-25(3,4)16-28;2-1-3/h14-15,17H,6-13,16H2,1-5H3,(H,26,27);1H,(H,2,3) |
| InChIKey | NJOWNMFEWGFMJE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|