C25H33N5O3S — CID 163861205
6-methoxy-2-(2-methyl-1,3-thiazol-5-yl)-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 163861205) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is 6-methoxy-2-(2-methyl-1,3-thiazol-5-yl)-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | 6-methoxy-2-(2-methyl-1,3-thiazol-5-yl)-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 163861205 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 6-methoxy-2-(2-methyl-1,3-thiazol-5-yl)-N-(oxan-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCOCC3)nc(-c3cnc(C)s3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H33N5O3S/c1-17-26-16-23(34-17)25-28-20-15-22(33-11-5-10-30-8-3-4-9-30)21(31-2)14-19(20)24(29-25)27-18-6-12-32-13-7-18/h14-16,18H,3-13H2,1-2H3,(H,27,28,29) |
| InChIKey | FHDNTVFEVYUJNS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|