C23H34ClN5O4 — CID 130454633
tert-butyl 4-[7-(3-chloropropoxy)-2-(dimethylamino)-6-methoxyquinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 130454633) has the molecular formula C23H34ClN5O4 and a molecular weight of 480.01 g/mol. Its IUPAC name is tert-butyl 4-[7-(3-chloropropoxy)-2-(dimethylamino)-6-methoxyquinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-(3-chloropropoxy)-2-(dimethylamino)-6-methoxyquinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 130454633 |
| Molecular Formula | C23H34ClN5O4 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | tert-butyl 4-[7-(3-chloropropoxy)-2-(dimethylamino)-6-methoxyquinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | COc1cc2c(N3CCN(C(=O)OC(C)(C)C)CC3)nc(N(C)C)nc2cc1OCCCCl |
| InChI | InChI=1S/C23H34ClN5O4/c1-23(2,3)33-22(30)29-11-9-28(10-12-29)20-16-14-18(31-6)19(32-13-7-8-24)15-17(16)25-21(26-20)27(4)5/h14-15H,7-13H2,1-6H3 |
| InChIKey | UTTGEGPCAWNPEI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|