C18H21F3N4O3 — CID 178126716
tert-butyl 4-[7-(difluoromethoxy)-6-fluoroquinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 178126716) has the molecular formula C18H21F3N4O3 and a molecular weight of 398.39 g/mol. Its IUPAC name is tert-butyl 4-[7-(difluoromethoxy)-6-fluoroquinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-(difluoromethoxy)-6-fluoroquinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178126716 |
| Molecular Formula | C18H21F3N4O3 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl 4-[7-(difluoromethoxy)-6-fluoroquinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc3cc(OC(F)F)c(F)cc23)CC1 |
| InChI | InChI=1S/C18H21F3N4O3/c1-18(2,3)28-17(26)25-6-4-24(5-7-25)15-11-8-12(19)14(27-16(20)21)9-13(11)22-10-23-15/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | VMADLRLHUFIPFI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |