C25H35BF2N4O4 — CID 148655506
tert-butyl 4-[6-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 148655506) has the molecular formula C25H35BF2N4O4 and a molecular weight of 504.39 g/mol. Its IUPAC name is tert-butyl 4-[6-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 148655506 |
| Molecular Formula | C25H35BF2N4O4 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | tert-butyl 4-[6-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc3cc(B4OC(C)(C)C(C)(C)O4)c(C(C)(F)F)cc23)CC1 |
| InChI | InChI=1S/C25H35BF2N4O4/c1-22(2,3)34-21(33)32-11-9-31(10-12-32)20-16-13-17(25(8,27)28)18(14-19(16)29-15-30-20)26-35-23(4,5)24(6,7)36-26/h13-15H,9-12H2,1-8H3 |
| InChIKey | NMTFNEZYSQGKHA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|