C16H14ClN3O2S — CID 122499744
N-(4-chloro-2-pyridinyl)-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 122499744) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is N-(4-chloro-2-pyridinyl)-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-chloro-2-pyridinyl)-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 122499744 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(4-chloro-2-pyridinyl)-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(Nc3cc(Cl)ccn3)n2)cc1OC |
| InChI | InChI=1S/C16H14ClN3O2S/c1-21-13-4-3-10(7-14(13)22-2)12-9-23-16(19-12)20-15-8-11(17)5-6-18-15/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | NCUCJKIPXSTIQC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |