C17H17NO4 — CID 11771002
4-(2,3,4,6-tetramethoxyphenyl)benzonitrile (PubChem CID 11771002) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-(2,3,4,6-tetramethoxyphenyl)benzonitrile.
| Compound Name | 4-(2,3,4,6-tetramethoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 11771002 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-(2,3,4,6-tetramethoxyphenyl)benzonitrile |
| SMILES | COc1cc(OC)c(-c2ccc(C#N)cc2)c(OC)c1OC |
| InChI | InChI=1S/C17H17NO4/c1-19-13-9-14(20-2)16(21-3)17(22-4)15(13)12-7-5-11(10-18)6-8-12/h5-9H,1-4H3 |
| InChIKey | OBXMUMPVPHLNEK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |