C21H25NO3 — CID 134322082
4-[[2,4,6-trimethoxy-3-(2-methylpropyl)phenyl]methyl]benzonitrile (PubChem CID 134322082) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[[2,4,6-trimethoxy-3-(2-methylpropyl)phenyl]methyl]benzonitrile.
| Compound Name | 4-[[2,4,6-trimethoxy-3-(2-methylpropyl)phenyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 134322082 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[[2,4,6-trimethoxy-3-(2-methylpropyl)phenyl]methyl]benzonitrile |
| SMILES | COc1cc(OC)c(CC(C)C)c(OC)c1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-14(2)10-17-19(23-3)12-20(24-4)18(21(17)25-5)11-15-6-8-16(13-22)9-7-15/h6-9,12,14H,10-11H2,1-5H3 |
| InChIKey | LEVOMGORUMZJAK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |