About (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile
(4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile (PubChem CID 159439294) has the molecular formula C21H17BN2O4
and a molecular weight of 372.19 g/mol. Its IUPAC name is (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile.
Molecular Properties
| Compound Name | (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile |
| PubChem CID | 159439294 |
| Molecular Formula | C21H17BN2O4 |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile |
| SMILES | COc1cc(-c2ccc(C#N)cc2)ccc1O.N#Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C14H11NO2.C7H6BNO2/c1-17-14-8-12(6-7-13(14)16)11-4-2-10(9-15)3-5-11;9-5-6-1-3-7(4-2-6)8(10)11/h2-8,16H,1H3;1-4,10-11H |
| InChIKey | LRYULIBBDXZNCZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile?
The IUPAC name of (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile (CID 159439294) is (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile.
What is the SMILES notation for (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile?
The canonical SMILES for (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile is COc1cc(-c2ccc(C#N)cc2)ccc1O.N#Cc1ccc(B(O)O)cc1.
What is the InChIKey of (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile?
The InChIKey is LRYULIBBDXZNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2.C7H6BNO2/c1-17-14-8-12(6-7-13(14)16)11-4-2-10(9-15)3-5-11;9-5-6-1-3-7(4-2-6)8(10)11/h2-8,16H,1H3;1-4,10-11H.
What are the key properties of (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile?
(4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile has a molecular weight of 372.19 g/mol, XLogP of 2.18, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)boronic acid;4-(4-hydroxy-3-methoxyphenyl)benzonitrile is sourced from PubChem (CID 159439294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).