C13H11NO2S — CID 25132175
5-(3,4-dimethoxyphenyl)thiophene-2-carbonitrile (PubChem CID 25132175) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)thiophene-2-carbonitrile.
| Compound Name | 5-(3,4-dimethoxyphenyl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 25132175 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)thiophene-2-carbonitrile |
| SMILES | COc1ccc(-c2ccc(C#N)s2)cc1OC |
| InChI | InChI=1S/C13H11NO2S/c1-15-11-5-3-9(7-12(11)16-2)13-6-4-10(8-14)17-13/h3-7H,1-2H3 |
| InChIKey | NVYZGVJLGHBTOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |