C13H11NS — CID 173192576
2-(2-methyl-1H-inden-4-yl)-1,3-thiazole (PubChem CID 173192576) has the molecular formula C13H11NS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(2-methyl-1H-inden-4-yl)-1,3-thiazole.
| Compound Name | 2-(2-methyl-1H-inden-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 173192576 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-(2-methyl-1H-inden-4-yl)-1,3-thiazole |
| SMILES | CC1=Cc2c(cccc2-c2nccs2)C1 |
| InChI | InChI=1S/C13H11NS/c1-9-7-10-3-2-4-11(12(10)8-9)13-14-5-6-15-13/h2-6,8H,7H2,1H3 |
| InChIKey | IGAUAGNUWVKDSE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |