C10H11ClN2S — CID 52983593
[2-(1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride (PubChem CID 52983593) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride.
| Compound Name | [2-(1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 52983593 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | [2-(1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1ccccc1-c1nccs1 |
| InChI | InChI=1S/C10H10N2S.ClH/c11-7-8-3-1-2-4-9(8)10-12-5-6-13-10;/h1-6H,7,11H2;1H |
| InChIKey | CZVFYMGNLHDZBB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |