C10H10N2S — CID 20773071
phenyl(1,3-thiazol-2-yl)methanamine (PubChem CID 20773071) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is phenyl(1,3-thiazol-2-yl)methanamine.
| Compound Name | phenyl(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 20773071 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | phenyl(1,3-thiazol-2-yl)methanamine |
| SMILES | NC(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C10H10N2S/c11-9(10-12-6-7-13-10)8-4-2-1-3-5-8/h1-7,9H,11H2 |
| InChIKey | RNIPFQCVVHTZST-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |