C63H78N2 — CID 158152356
2,3,4,5-tetramethyl-1H-indene;2,3,4,6-tetramethyl-1H-indene;2,3,4,7-tetramethyl-1H-indene;1,2,5,8-tetramethylindolizine;1,2,6,8-tetramethylindolizine (PubChem CID 158152356) has the molecular formula C63H78N2 and a molecular weight of 863.33 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-1H-indene;2,3,4,6-tetramethyl-1H-indene;2,3,4,7-tetramethyl-1H-indene;1,2,5,8-tetramethylindolizine;1,2,6,8-tetramethylindolizine.
| Compound Name | 2,3,4,5-tetramethyl-1H-indene;2,3,4,6-tetramethyl-1H-indene;2,3,4,7-tetramethyl-1H-indene;1,2,5,8-tetramethylindolizine;1,2,6,8-tetramethylindolizine |
|---|---|
| PubChem CID | 158152356 |
| Molecular Formula | C63H78N2 |
| Molecular Weight | 863.33 g/mol |
| Exact Mass | 862.62 |
| IUPAC Name | 2,3,4,5-tetramethyl-1H-indene;2,3,4,6-tetramethyl-1H-indene;2,3,4,7-tetramethyl-1H-indene;1,2,5,8-tetramethylindolizine;1,2,6,8-tetramethylindolizine |
| SMILES | CC1=C(C)c2c(C)cc(C)cc2C1.CC1=C(C)c2c(C)ccc(C)c2C1.CC1=C(C)c2c(ccc(C)c2C)C1.Cc1cc(C)c2c(C)c(C)cn2c1.Cc1cn2c(C)ccc(C)c2c1C |
| InChI | InChI=1S/3C13H16.2C12H15N/c1-8-5-10(3)13-11(4)9(2)7-12(13)6-8;1-8-5-6-12-7-9(2)11(4)13(12)10(8)3;1-8-5-6-9(2)13-11(4)10(3)7-12(8)13;1-8-5-9(2)12-11(4)10(3)7-13(12)6-8;1-8-5-6-10(3)13-7-9(2)11(4)12(8)13/h3*5-6H,7H2,1-4H3;2*5-7H,1-4H3 |
| InChIKey | FVGPLUVZSHWFIR-UHFFFAOYSA-N |
| XLogP | 17.30 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.33 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |