About 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene
1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene (PubChem CID 173377098) has the molecular formula C19H24
and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene.
Analyze 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene?
The IUPAC name of 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene (CID 173377098) is 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene.
What is the SMILES notation for 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene?
The canonical SMILES for 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene is Cc1ccc(C)c(-c2c(C)c(C)cc(C)c2C)c1C.
What is the InChIKey of 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene?
The InChIKey is QWJOWQBXPMXFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24/c1-11-8-9-12(2)18(15(11)5)19-16(6)13(3)10-14(4)17(19)7/h8-10H,1-7H3.
What are the key properties of 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene?
1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene has a molecular weight of 252.40 g/mol, XLogP of 5.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,5-tetramethyl-3-(2,3,6-trimethylphenyl)benzene is sourced from PubChem (CID 173377098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).