C17H15NO2 — CID 11448478
methyl 11,12-dihydrobenzo[c][1]benzazocine-6-carboxylate (PubChem CID 11448478) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 11,12-dihydrobenzo[c][1]benzazocine-6-carboxylate.
| Compound Name | methyl 11,12-dihydrobenzo[c][1]benzazocine-6-carboxylate |
|---|---|
| PubChem CID | 11448478 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 11,12-dihydrobenzo[c][1]benzazocine-6-carboxylate |
| SMILES | COC(=O)/C1=N/c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H15NO2/c1-20-17(19)16-14-8-4-2-6-12(14)10-11-13-7-3-5-9-15(13)18-16/h2-9H,10-11H2,1H3/b18-16+ |
| InChIKey | RAQRNGPFOJSRJP-FBMGVBCBSA-N |
| XLogP | 3.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |