C15H13NO3 — CID 162402314
methyl 3-hydroxy-5,6-dihydrobenzo[h]quinoline-4-carboxylate (PubChem CID 162402314) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 3-hydroxy-5,6-dihydrobenzo[h]quinoline-4-carboxylate.
| Compound Name | methyl 3-hydroxy-5,6-dihydrobenzo[h]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 162402314 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 3-hydroxy-5,6-dihydrobenzo[h]quinoline-4-carboxylate |
| SMILES | COC(=O)c1c(O)cnc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO3/c1-19-15(18)13-11-7-6-9-4-2-3-5-10(9)14(11)16-8-12(13)17/h2-5,8,17H,6-7H2,1H3 |
| InChIKey | RFWUJCCFMWHYOK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |