methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate

C15H15NO3 — CID 10825029

IUPACmethyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate
SMILESCOC(=O)C1=C2c3ccccc3CCN2C(=O)CC1
InChIInChI=1S/C15H15NO3/c1-19-15(18)12-6-7-13(17)16-9-8-10-4-2-3-5-11(10)14(12)16/h2-5H,6-9H2,1H3
InChIKeyKJOGSVZPEAEJNG-UHFFFAOYSA-N
MW257.29 g/mol
LogP1.75
Rot. Bonds1

About methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate

methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate (PubChem CID 10825029) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate
PubChem CID10825029
Molecular FormulaC15H15NO3
Molecular Weight257.29 g/mol
Exact Mass257.11
IUPAC Namemethyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate
SMILESCOC(=O)C1=C2c3ccccc3CCN2C(=O)CC1
InChIInChI=1S/C15H15NO3/c1-19-15(18)12-6-7-13(17)16-9-8-10-4-2-3-5-11(10)14(12)16/h2-5H,6-9H2,1H3
InChIKeyKJOGSVZPEAEJNG-UHFFFAOYSA-N
XLogP1.75
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate?
The IUPAC name of methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate (CID 10825029) is methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate.
What is the SMILES notation for methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate?
The canonical SMILES for methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate is COC(=O)C1=C2c3ccccc3CCN2C(=O)CC1.
What is the InChIKey of methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate?
The InChIKey is KJOGSVZPEAEJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c1-19-15(18)12-6-7-13(17)16-9-8-10-4-2-3-5-11(10)14(12)16/h2-5H,6-9H2,1H3.
What are the key properties of methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate?
methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate has a molecular weight of 257.29 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-2,3,6,7-tetrahydrobenzo[a]quinolizine-1-carboxylate is sourced from PubChem (CID 10825029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).