C20H21NO — CID 177494103
(2Z)-2-[1-[[(1R)-1-phenylethyl]amino]ethylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 177494103) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (2Z)-2-[1-[[(1R)-1-phenylethyl]amino]ethylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2Z)-2-[1-[[(1R)-1-phenylethyl]amino]ethylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 177494103 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2Z)-2-[1-[[(1R)-1-phenylethyl]amino]ethylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | C/C(N[C@H](C)c1ccccc1)=C1\CCc2ccccc2C1=O |
| InChI | InChI=1S/C20H21NO/c1-14(16-8-4-3-5-9-16)21-15(2)18-13-12-17-10-6-7-11-19(17)20(18)22/h3-11,14,21H,12-13H2,1-2H3/b18-15-/t14-/m1/s1 |
| InChIKey | LTLQRWWTVAEDGP-QFVIEVDGSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|