carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide

C13H13CrNO4 — CID 14362564

IUPACcarbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide
SMILESCC(=O)N[C@H](C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
InChIInChI=1S/C10H13NO.3CO.Cr/c1-8(11-9(2)12)10-6-4-3-5-7-10;3*1-2;/h3-8H,1-2H3,(H,11,12);;;;/t8-;;;;/m1..../s1
InChIKeyNNYDCQLLBVXSBN-XWCOYVICSA-N
MW299.25 g/mol
LogP1.77
Rot. Bonds2

About carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide

carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide (PubChem CID 14362564) has the molecular formula C13H13CrNO4 and a molecular weight of 299.25 g/mol. Its IUPAC name is carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide.

Molecular Properties

Compound Namecarbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide
PubChem CID14362564
Molecular FormulaC13H13CrNO4
Molecular Weight299.25 g/mol
Exact Mass299.02
IUPAC Namecarbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide
SMILESCC(=O)N[C@H](C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
InChIInChI=1S/C10H13NO.3CO.Cr/c1-8(11-9(2)12)10-6-4-3-5-7-10;3*1-2;/h3-8H,1-2H3,(H,11,12);;;;/t8-;;;;/m1..../s1
InChIKeyNNYDCQLLBVXSBN-XWCOYVICSA-N
XLogP1.77
TPSA88.80 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.25
LogP ≤ 51.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide?
The IUPAC name of carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide (CID 14362564) is carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide.
What is the SMILES notation for carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide?
The canonical SMILES for carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide is CC(=O)N[C@H](C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide?
The InChIKey is NNYDCQLLBVXSBN-XWCOYVICSA-N. The full InChI is InChI=1S/C10H13NO.3CO.Cr/c1-8(11-9(2)12)10-6-4-3-5-7-10;3*1-2;/h3-8H,1-2H3,(H,11,12);;;;/t8-;;;;/m1..../s1.
What are the key properties of carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide?
carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide has a molecular weight of 299.25 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;N-[(1R)-1-phenylethyl]acetamide is sourced from PubChem (CID 14362564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).