C21H16OS — CID 171477739
(2E)-2-[phenyl(thiophen-2-yl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 171477739) has the molecular formula C21H16OS and a molecular weight of 316.43 g/mol. Its IUPAC name is (2E)-2-[phenyl(thiophen-2-yl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[phenyl(thiophen-2-yl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 171477739 |
| Molecular Formula | C21H16OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2E)-2-[phenyl(thiophen-2-yl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=C(\c2ccccc2)c2cccs2)CCc2ccccc21 |
| InChI | InChI=1S/C21H16OS/c22-21-17-10-5-4-7-15(17)12-13-18(21)20(19-11-6-14-23-19)16-8-2-1-3-9-16/h1-11,14H,12-13H2/b20-18+ |
| InChIKey | HNUYSTVPNGJJLI-CZIZESTLSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|