C22H17NO2S — CID 12925016
(3E)-3-[(4-methylphenyl)-thiophen-2-ylmethylidene]-1-phenylpyrrolidine-2,5-dione (PubChem CID 12925016) has the molecular formula C22H17NO2S and a molecular weight of 359.45 g/mol. Its IUPAC name is (3E)-3-[(4-methylphenyl)-thiophen-2-ylmethylidene]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[(4-methylphenyl)-thiophen-2-ylmethylidene]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 12925016 |
| Molecular Formula | C22H17NO2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (3E)-3-[(4-methylphenyl)-thiophen-2-ylmethylidene]-1-phenylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(/C(=C2/CC(=O)N(c3ccccc3)C2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H17NO2S/c1-15-9-11-16(12-10-15)21(19-8-5-13-26-19)18-14-20(24)23(22(18)25)17-6-3-2-4-7-17/h2-13H,14H2,1H3/b21-18+ |
| InChIKey | FQKWZTYBHHJDGB-DYTRJAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|