C20H18N2O2 — CID 22427636
N-(1-phenylethyl)-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide (PubChem CID 22427636) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(1-phenylethyl)-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide.
| Compound Name | N-(1-phenylethyl)-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 22427636 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(1-phenylethyl)-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
| SMILES | CC(NC(=O)c1noc2c1CCc1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O2/c1-13(14-7-3-2-4-8-14)21-20(23)18-17-12-11-15-9-5-6-10-16(15)19(17)24-22-18/h2-10,13H,11-12H2,1H3,(H,21,23) |
| InChIKey | CFPVHTMIUXGWJK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |