C10H8Cl2N2O5 — CID 162332755
acetic acid;2-(2,6-dichloro-4-nitrophenoxy)acetonitrile (PubChem CID 162332755) has the molecular formula C10H8Cl2N2O5 and a molecular weight of 307.09 g/mol. Its IUPAC name is acetic acid;2-(2,6-dichloro-4-nitrophenoxy)acetonitrile.
| Compound Name | acetic acid;2-(2,6-dichloro-4-nitrophenoxy)acetonitrile |
|---|---|
| PubChem CID | 162332755 |
| Molecular Formula | C10H8Cl2N2O5 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | acetic acid;2-(2,6-dichloro-4-nitrophenoxy)acetonitrile |
| SMILES | CC(=O)O.N#CCOc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C8H4Cl2N2O3.C2H4O2/c9-6-3-5(12(13)14)4-7(10)8(6)15-2-1-11;1-2(3)4/h3-4H,2H2;1H3,(H,3,4) |
| InChIKey | BDMUDHMMMOOLIW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|