C13H7Br2N3O3 — CID 62920278
3-[(2,6-dibromo-4-nitrophenoxy)methyl]pyridine-2-carbonitrile (PubChem CID 62920278) has the molecular formula C13H7Br2N3O3 and a molecular weight of 413.03 g/mol. Its IUPAC name is 3-[(2,6-dibromo-4-nitrophenoxy)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(2,6-dibromo-4-nitrophenoxy)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62920278 |
| Molecular Formula | C13H7Br2N3O3 |
| Molecular Weight | 413.03 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | 3-[(2,6-dibromo-4-nitrophenoxy)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1COc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H7Br2N3O3/c14-10-4-9(18(19)20)5-11(15)13(10)21-7-8-2-1-3-17-12(8)6-16/h1-5H,7H2 |
| InChIKey | BHUMAGQLUMNDIL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|