C13H10ClN3O3S — CID 82913966
3-chloro-4-[(2-cyano-3-pyridinyl)methoxy]benzenesulfonamide (PubChem CID 82913966) has the molecular formula C13H10ClN3O3S and a molecular weight of 323.76 g/mol. Its IUPAC name is 3-chloro-4-[(2-cyano-3-pyridinyl)methoxy]benzenesulfonamide.
| Compound Name | 3-chloro-4-[(2-cyano-3-pyridinyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82913966 |
| Molecular Formula | C13H10ClN3O3S |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-chloro-4-[(2-cyano-3-pyridinyl)methoxy]benzenesulfonamide |
| SMILES | N#Cc1ncccc1COc1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C13H10ClN3O3S/c14-11-6-10(21(16,18)19)3-4-13(11)20-8-9-2-1-5-17-12(9)7-15/h1-6H,8H2,(H2,16,18,19) |
| InChIKey | OPMOGSHCMZKYEO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |